C12H9ClN2O — CID 116623604
5-[(4-chloroindol-1-yl)methyl]-1,2-oxazole (PubChem CID 116623604) has the molecular formula C12H9ClN2O and a molecular weight of 232.67 g/mol. Its IUPAC name is 5-[(4-chloroindol-1-yl)methyl]-1,2-oxazole.
| Compound Name | 5-[(4-chloroindol-1-yl)methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 116623604 |
| Molecular Formula | C12H9ClN2O |
| Molecular Weight | 232.67 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 5-[(4-chloroindol-1-yl)methyl]-1,2-oxazole |
| SMILES | Clc1cccc2c1ccn2Cc1ccno1 |
| InChI | InChI=1S/C12H9ClN2O/c13-11-2-1-3-12-10(11)5-7-15(12)8-9-4-6-14-16-9/h1-7H,8H2 |
| InChIKey | LCCYLSNSEFJYQK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.67 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |