C15H17ClN2O3 — CID 91641076
methyl (2S)-2-[3-(4-chloroindol-1-yl)propanoylamino]propanoate (PubChem CID 91641076) has the molecular formula C15H17ClN2O3 and a molecular weight of 308.77 g/mol. Its IUPAC name is methyl (2S)-2-[3-(4-chloroindol-1-yl)propanoylamino]propanoate.
| Compound Name | methyl (2S)-2-[3-(4-chloroindol-1-yl)propanoylamino]propanoate |
|---|---|
| PubChem CID | 91641076 |
| Molecular Formula | C15H17ClN2O3 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | methyl (2S)-2-[3-(4-chloroindol-1-yl)propanoylamino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)CCn1ccc2c(Cl)cccc21 |
| InChI | InChI=1S/C15H17ClN2O3/c1-10(15(20)21-2)17-14(19)7-9-18-8-6-11-12(16)4-3-5-13(11)18/h3-6,8,10H,7,9H2,1-2H3,(H,17,19)/t10-/m0/s1 |
| InChIKey | JZWLJXURNSDTJW-JTQLQIEISA-N |
| XLogP | 2.36 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |