C18H15ClN2O3 — CID 45496037
(2R)-2-[[2-(4-chloroindol-1-yl)acetyl]amino]-2-phenylacetic acid (PubChem CID 45496037) has the molecular formula C18H15ClN2O3 and a molecular weight of 342.78 g/mol. Its IUPAC name is (2R)-2-[[2-(4-chloroindol-1-yl)acetyl]amino]-2-phenylacetic acid.
| Compound Name | (2R)-2-[[2-(4-chloroindol-1-yl)acetyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 45496037 |
| Molecular Formula | C18H15ClN2O3 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | (2R)-2-[[2-(4-chloroindol-1-yl)acetyl]amino]-2-phenylacetic acid |
| SMILES | O=C(Cn1ccc2c(Cl)cccc21)N[C@@H](C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C18H15ClN2O3/c19-14-7-4-8-15-13(14)9-10-21(15)11-16(22)20-17(18(23)24)12-5-2-1-3-6-12/h1-10,17H,11H2,(H,20,22)(H,23,24)/t17-/m1/s1 |
| InChIKey | MYZXBWYDOLSDIF-QGZVFWFLSA-N |
| XLogP | 3.24 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |