C12H10ClF3N2O — CID 116623796
2-(4-chloroindol-1-yl)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 116623796) has the molecular formula C12H10ClF3N2O and a molecular weight of 290.67 g/mol. Its IUPAC name is 2-(4-chloroindol-1-yl)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(4-chloroindol-1-yl)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 116623796 |
| Molecular Formula | C12H10ClF3N2O |
| Molecular Weight | 290.67 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 2-(4-chloroindol-1-yl)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(Cn1ccc2c(Cl)cccc21)NCC(F)(F)F |
| InChI | InChI=1S/C12H10ClF3N2O/c13-9-2-1-3-10-8(9)4-5-18(10)6-11(19)17-7-12(14,15)16/h1-5H,6-7H2,(H,17,19) |
| InChIKey | NAUJSTIRBYUSJF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.67 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |