C16H19ClN2O3 — CID 45492894
6-[[2-(4-chloroindol-1-yl)acetyl]amino]hexanoic acid (PubChem CID 45492894) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is 6-[[2-(4-chloroindol-1-yl)acetyl]amino]hexanoic acid.
| Compound Name | 6-[[2-(4-chloroindol-1-yl)acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 45492894 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 6-[[2-(4-chloroindol-1-yl)acetyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)Cn1ccc2c(Cl)cccc21 |
| InChI | InChI=1S/C16H19ClN2O3/c17-13-5-4-6-14-12(13)8-10-19(14)11-15(20)18-9-3-1-2-7-16(21)22/h4-6,8,10H,1-3,7,9,11H2,(H,18,20)(H,21,22) |
| InChIKey | NLTOJFMVAXQZLF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|