C17H21ClN2O3 — CID 124645308
(2R)-2-[3-(4-chloroindol-1-yl)propanoylamino]-4-methylpentanoic acid (PubChem CID 124645308) has the molecular formula C17H21ClN2O3 and a molecular weight of 336.82 g/mol. Its IUPAC name is (2R)-2-[3-(4-chloroindol-1-yl)propanoylamino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[3-(4-chloroindol-1-yl)propanoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 124645308 |
| Molecular Formula | C17H21ClN2O3 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | (2R)-2-[3-(4-chloroindol-1-yl)propanoylamino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](NC(=O)CCn1ccc2c(Cl)cccc21)C(=O)O |
| InChI | InChI=1S/C17H21ClN2O3/c1-11(2)10-14(17(22)23)19-16(21)7-9-20-8-6-12-13(18)4-3-5-15(12)20/h3-6,8,11,14H,7,9-10H2,1-2H3,(H,19,21)(H,22,23)/t14-/m1/s1 |
| InChIKey | XRXILJVGUFRWOZ-CQSZACIVSA-N |
| XLogP | 3.30 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |