C20H28N2O3 — CID 139679248
2-(4-methylpentanoylamino)-3-(1-propylindol-3-yl)propanoic acid (PubChem CID 139679248) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is 2-(4-methylpentanoylamino)-3-(1-propylindol-3-yl)propanoic acid.
| Compound Name | 2-(4-methylpentanoylamino)-3-(1-propylindol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 139679248 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 2-(4-methylpentanoylamino)-3-(1-propylindol-3-yl)propanoic acid |
| SMILES | CCCn1cc(CC(NC(=O)CCC(C)C)C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C20H28N2O3/c1-4-11-22-13-15(16-7-5-6-8-18(16)22)12-17(20(24)25)21-19(23)10-9-14(2)3/h5-8,13-14,17H,4,9-12H2,1-3H3,(H,21,23)(H,24,25) |
| InChIKey | KCKOWBBSAWXENS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |