C22H30N2O4 — CID 139679237
(2S)-2-(4-methylpentanoylamino)-3-(1-pentanoylindol-3-yl)propanoic acid (PubChem CID 139679237) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is (2S)-2-(4-methylpentanoylamino)-3-(1-pentanoylindol-3-yl)propanoic acid.
| Compound Name | (2S)-2-(4-methylpentanoylamino)-3-(1-pentanoylindol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 139679237 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | (2S)-2-(4-methylpentanoylamino)-3-(1-pentanoylindol-3-yl)propanoic acid |
| SMILES | CCCCC(=O)n1cc(C[C@H](NC(=O)CCC(C)C)C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C22H30N2O4/c1-4-5-10-21(26)24-14-16(17-8-6-7-9-19(17)24)13-18(22(27)28)23-20(25)12-11-15(2)3/h6-9,14-15,18H,4-5,10-13H2,1-3H3,(H,23,25)(H,27,28)/t18-/m0/s1 |
| InChIKey | MZBLPQZDTKLYJJ-SFHVURJKSA-N |
| XLogP | 4.02 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |