C12H15BrCl2O — CID 65011768
2-[2-(bromomethyl)-3-methylbutoxy]-1,3-dichlorobenzene (PubChem CID 65011768) has the molecular formula C12H15BrCl2O and a molecular weight of 326.06 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-3-methylbutoxy]-1,3-dichlorobenzene.
| Compound Name | 2-[2-(bromomethyl)-3-methylbutoxy]-1,3-dichlorobenzene |
|---|---|
| PubChem CID | 65011768 |
| Molecular Formula | C12H15BrCl2O |
| Molecular Weight | 326.06 g/mol |
| Exact Mass | 323.97 |
| IUPAC Name | 2-[2-(bromomethyl)-3-methylbutoxy]-1,3-dichlorobenzene |
| SMILES | CC(C)C(CBr)COc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H15BrCl2O/c1-8(2)9(6-13)7-16-12-10(14)4-3-5-11(12)15/h3-5,8-9H,6-7H2,1-2H3 |
| InChIKey | CMSIFFDSXXGCAR-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.06 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|