C8H10Cl2N2 — CID 124596349
[(1S)-1-(2,6-dichlorophenyl)ethyl]hydrazine (PubChem CID 124596349) has the molecular formula C8H10Cl2N2 and a molecular weight of 205.09 g/mol. Its IUPAC name is [(1S)-1-(2,6-dichlorophenyl)ethyl]hydrazine.
| Compound Name | [(1S)-1-(2,6-dichlorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 124596349 |
| Molecular Formula | C8H10Cl2N2 |
| Molecular Weight | 205.09 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | [(1S)-1-(2,6-dichlorophenyl)ethyl]hydrazine |
| SMILES | C[C@H](NN)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C8H10Cl2N2/c1-5(12-11)8-6(9)3-2-4-7(8)10/h2-5,12H,11H2,1H3/t5-/m0/s1 |
| InChIKey | NUGVRIWTZLKNST-YFKPBYRVSA-N |
| XLogP | 2.52 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.09 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|