C13H12Cl2N2 — CID 105282940
[(2,6-dichlorophenyl)-phenylmethyl]hydrazine (PubChem CID 105282940) has the molecular formula C13H12Cl2N2 and a molecular weight of 267.16 g/mol. Its IUPAC name is [(2,6-dichlorophenyl)-phenylmethyl]hydrazine.
| Compound Name | [(2,6-dichlorophenyl)-phenylmethyl]hydrazine |
|---|---|
| PubChem CID | 105282940 |
| Molecular Formula | C13H12Cl2N2 |
| Molecular Weight | 267.16 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | [(2,6-dichlorophenyl)-phenylmethyl]hydrazine |
| SMILES | NNC(c1ccccc1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H12Cl2N2/c14-10-7-4-8-11(15)12(10)13(17-16)9-5-2-1-3-6-9/h1-8,13,17H,16H2 |
| InChIKey | FOSUDWAAQAWGKL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.16 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|