C13H9BrCl2 — CID 63437122
2-[bromo(phenyl)methyl]-1,3-dichlorobenzene (PubChem CID 63437122) has the molecular formula C13H9BrCl2 and a molecular weight of 316.03 g/mol. Its IUPAC name is 2-[bromo(phenyl)methyl]-1,3-dichlorobenzene.
| Compound Name | 2-[bromo(phenyl)methyl]-1,3-dichlorobenzene |
|---|---|
| PubChem CID | 63437122 |
| Molecular Formula | C13H9BrCl2 |
| Molecular Weight | 316.03 g/mol |
| Exact Mass | 313.93 |
| IUPAC Name | 2-[bromo(phenyl)methyl]-1,3-dichlorobenzene |
| SMILES | Clc1cccc(Cl)c1C(Br)c1ccccc1 |
| InChI | InChI=1S/C13H9BrCl2/c14-13(9-5-2-1-3-6-9)12-10(15)7-4-8-11(12)16/h1-8,13H |
| InChIKey | RFYQWWYPBWDCEE-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.03 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|