C9H16Cl2N4O9S2 — CID 159030999
2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine;sulfuric acid (PubChem CID 159030999) has the molecular formula C9H16Cl2N4O9S2 and a molecular weight of 459.29 g/mol. Its IUPAC name is 2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine;sulfuric acid.
| Compound Name | 2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine;sulfuric acid |
|---|---|
| PubChem CID | 159030999 |
| Molecular Formula | C9H16Cl2N4O9S2 |
| Molecular Weight | 459.29 g/mol |
| Exact Mass | 457.97 |
| IUPAC Name | 2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine;sulfuric acid |
| SMILES | NC(N)=NNCCOc1c(Cl)cccc1Cl.O=S(=O)(O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C9H12Cl2N4O.2H2O4S/c10-6-2-1-3-7(11)8(6)16-5-4-14-15-9(12)13;2*1-5(2,3)4/h1-3,14H,4-5H2,(H4,12,13,15);2*(H2,1,2,3,4) |
| InChIKey | JUWOLQZZYOSOMN-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 234.86 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.29 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|