C10H16ClN3O5S — CID 161092850
2-[2-(2-chloro-6-methylphenoxy)ethyl]guanidine;sulfuric acid (PubChem CID 161092850) has the molecular formula C10H16ClN3O5S and a molecular weight of 325.77 g/mol. Its IUPAC name is 2-[2-(2-chloro-6-methylphenoxy)ethyl]guanidine;sulfuric acid.
| Compound Name | 2-[2-(2-chloro-6-methylphenoxy)ethyl]guanidine;sulfuric acid |
|---|---|
| PubChem CID | 161092850 |
| Molecular Formula | C10H16ClN3O5S |
| Molecular Weight | 325.77 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 2-[2-(2-chloro-6-methylphenoxy)ethyl]guanidine;sulfuric acid |
| SMILES | Cc1cccc(Cl)c1OCCN=C(N)N.O=S(=O)(O)O |
| InChI | InChI=1S/C10H14ClN3O.H2O4S/c1-7-3-2-4-8(11)9(7)15-6-5-14-10(12)13;1-5(2,3)4/h2-4H,5-6H2,1H3,(H4,12,13,14);(H2,1,2,3,4) |
| InChIKey | UHKHAQCLGZOYKX-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.77 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|