C16H18O2 — CID 78906435
1,3-dimethyl-2-(2-phenoxyethoxy)benzene (PubChem CID 78906435) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 1,3-dimethyl-2-(2-phenoxyethoxy)benzene.
| Compound Name | 1,3-dimethyl-2-(2-phenoxyethoxy)benzene |
|---|---|
| PubChem CID | 78906435 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 1,3-dimethyl-2-(2-phenoxyethoxy)benzene |
| SMILES | Cc1cccc(C)c1OCCOc1ccccc1 |
| InChI | InChI=1S/C16H18O2/c1-13-7-6-8-14(2)16(13)18-12-11-17-15-9-4-3-5-10-15/h3-10H,11-12H2,1-2H3 |
| InChIKey | LTQDYXSLZCDOPI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|