C16H18O3 — CID 39359626
3-[2-(2,6-dimethylphenoxy)ethoxy]phenol (PubChem CID 39359626) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 3-[2-(2,6-dimethylphenoxy)ethoxy]phenol.
| Compound Name | 3-[2-(2,6-dimethylphenoxy)ethoxy]phenol |
|---|---|
| PubChem CID | 39359626 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 3-[2-(2,6-dimethylphenoxy)ethoxy]phenol |
| SMILES | Cc1cccc(C)c1OCCOc1cccc(O)c1 |
| InChI | InChI=1S/C16H18O3/c1-12-5-3-6-13(2)16(12)19-10-9-18-15-8-4-7-14(17)11-15/h3-8,11,17H,9-10H2,1-2H3 |
| InChIKey | ZHYFBOTWNKZCEQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|