C15H13O4- — CID 22241290
2-[(3-hydroxyphenoxy)methyl]-6-methylbenzoate (PubChem CID 22241290) has the molecular formula C15H13O4- and a molecular weight of 257.26 g/mol. Its IUPAC name is 2-[(3-hydroxyphenoxy)methyl]-6-methylbenzoate.
| Compound Name | 2-[(3-hydroxyphenoxy)methyl]-6-methylbenzoate |
|---|---|
| PubChem CID | 22241290 |
| Molecular Formula | C15H13O4- |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 2-[(3-hydroxyphenoxy)methyl]-6-methylbenzoate |
| SMILES | Cc1cccc(COc2cccc(O)c2)c1C(=O)[O-] |
| InChI | InChI=1S/C15H14O4/c1-10-4-2-5-11(14(10)15(17)18)9-19-13-7-3-6-12(16)8-13/h2-8,16H,9H2,1H3,(H,17,18)/p-1 |
| InChIKey | LDKLCVRBYMIFQX-UHFFFAOYSA-M |
| XLogP | 1.64 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |