About 3-(3-fluorobutoxy)phenol
3-(3-fluorobutoxy)phenol (PubChem CID 84659596) has the molecular formula C10H13FO2
and a molecular weight of 184.21 g/mol. Its IUPAC name is 3-(3-fluorobutoxy)phenol.
Molecular Properties
| Compound Name | 3-(3-fluorobutoxy)phenol |
| PubChem CID | 84659596 |
| Molecular Formula | C10H13FO2 |
| Molecular Weight | 184.21 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 3-(3-fluorobutoxy)phenol |
| SMILES | CC(F)CCOc1cccc(O)c1 |
| InChI | InChI=1S/C10H13FO2/c1-8(11)5-6-13-10-4-2-3-9(12)7-10/h2-4,7-8,12H,5-6H2,1H3 |
| InChIKey | IXDYEMFGWIPGGD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.21 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3-fluorobutoxy)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-fluorobutoxy)phenol?
The IUPAC name of 3-(3-fluorobutoxy)phenol (CID 84659596) is 3-(3-fluorobutoxy)phenol.
What is the SMILES notation for 3-(3-fluorobutoxy)phenol?
The canonical SMILES for 3-(3-fluorobutoxy)phenol is CC(F)CCOc1cccc(O)c1.
What is the InChIKey of 3-(3-fluorobutoxy)phenol?
The InChIKey is IXDYEMFGWIPGGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13FO2/c1-8(11)5-6-13-10-4-2-3-9(12)7-10/h2-4,7-8,12H,5-6H2,1H3.
What are the key properties of 3-(3-fluorobutoxy)phenol?
3-(3-fluorobutoxy)phenol has a molecular weight of 184.21 g/mol, XLogP of 2.52, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-fluorobutoxy)phenol is sourced from PubChem (CID 84659596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).