About 3-(3-fluorobutyl)phenol
3-(3-fluorobutyl)phenol (PubChem CID 84653086) has the molecular formula C10H13FO
and a molecular weight of 168.21 g/mol. Its IUPAC name is 3-(3-fluorobutyl)phenol.
Molecular Properties
| Compound Name | 3-(3-fluorobutyl)phenol |
| PubChem CID | 84653086 |
| Molecular Formula | C10H13FO |
| Molecular Weight | 168.21 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 3-(3-fluorobutyl)phenol |
| SMILES | CC(F)CCc1cccc(O)c1 |
| InChI | InChI=1S/C10H13FO/c1-8(11)5-6-9-3-2-4-10(12)7-9/h2-4,7-8,12H,5-6H2,1H3 |
| InChIKey | ASAOMZTVSVKLRA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.21 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(3-fluorobutyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-fluorobutyl)phenol?
The IUPAC name of 3-(3-fluorobutyl)phenol (CID 84653086) is 3-(3-fluorobutyl)phenol.
What is the SMILES notation for 3-(3-fluorobutyl)phenol?
The canonical SMILES for 3-(3-fluorobutyl)phenol is CC(F)CCc1cccc(O)c1.
What is the InChIKey of 3-(3-fluorobutyl)phenol?
The InChIKey is ASAOMZTVSVKLRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13FO/c1-8(11)5-6-9-3-2-4-10(12)7-9/h2-4,7-8,12H,5-6H2,1H3.
What are the key properties of 3-(3-fluorobutyl)phenol?
3-(3-fluorobutyl)phenol has a molecular weight of 168.21 g/mol, XLogP of 2.68, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-fluorobutyl)phenol is sourced from PubChem (CID 84653086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).