C12H16Cl2O2 — CID 54471375
3-(5,6-dichlorohexoxy)phenol (PubChem CID 54471375) has the molecular formula C12H16Cl2O2 and a molecular weight of 263.16 g/mol. Its IUPAC name is 3-(5,6-dichlorohexoxy)phenol.
| Compound Name | 3-(5,6-dichlorohexoxy)phenol |
|---|---|
| PubChem CID | 54471375 |
| Molecular Formula | C12H16Cl2O2 |
| Molecular Weight | 263.16 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 3-(5,6-dichlorohexoxy)phenol |
| SMILES | Oc1cccc(OCCCCC(Cl)CCl)c1 |
| InChI | InChI=1S/C12H16Cl2O2/c13-9-10(14)4-1-2-7-16-12-6-3-5-11(15)8-12/h3,5-6,8,10,15H,1-2,4,7,9H2 |
| InChIKey | NQFMWERECUJBKV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.16 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|