About 3-(2-hydroxypropoxy)phenol;2-methylpropane
3-(2-hydroxypropoxy)phenol;2-methylpropane (PubChem CID 144531306) has the molecular formula C13H22O3
and a molecular weight of 226.32 g/mol. Its IUPAC name is 3-(2-hydroxypropoxy)phenol;2-methylpropane.
Molecular Properties
| Compound Name | 3-(2-hydroxypropoxy)phenol;2-methylpropane |
| PubChem CID | 144531306 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 3-(2-hydroxypropoxy)phenol;2-methylpropane |
| SMILES | CC(C)C.CC(O)COc1cccc(O)c1 |
| InChI | InChI=1S/C9H12O3.C4H10/c1-7(10)6-12-9-4-2-3-8(11)5-9;1-4(2)3/h2-5,7,10-11H,6H2,1H3;4H,1-3H3 |
| InChIKey | RNDSKTQUXVWGSM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-hydroxypropoxy)phenol;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-hydroxypropoxy)phenol;2-methylpropane?
The IUPAC name of 3-(2-hydroxypropoxy)phenol;2-methylpropane (CID 144531306) is 3-(2-hydroxypropoxy)phenol;2-methylpropane.
What is the SMILES notation for 3-(2-hydroxypropoxy)phenol;2-methylpropane?
The canonical SMILES for 3-(2-hydroxypropoxy)phenol;2-methylpropane is CC(C)C.CC(O)COc1cccc(O)c1.
What is the InChIKey of 3-(2-hydroxypropoxy)phenol;2-methylpropane?
The InChIKey is RNDSKTQUXVWGSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3.C4H10/c1-7(10)6-12-9-4-2-3-8(11)5-9;1-4(2)3/h2-5,7,10-11H,6H2,1H3;4H,1-3H3.
What are the key properties of 3-(2-hydroxypropoxy)phenol;2-methylpropane?
3-(2-hydroxypropoxy)phenol;2-methylpropane has a molecular weight of 226.32 g/mol, XLogP of 2.81, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-hydroxypropoxy)phenol;2-methylpropane is sourced from PubChem (CID 144531306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).