C16H18ClNO2 — CID 39399797
2-chloro-5-[2-(2,6-dimethylphenoxy)ethoxy]aniline (PubChem CID 39399797) has the molecular formula C16H18ClNO2 and a molecular weight of 291.78 g/mol. Its IUPAC name is 2-chloro-5-[2-(2,6-dimethylphenoxy)ethoxy]aniline.
| Compound Name | 2-chloro-5-[2-(2,6-dimethylphenoxy)ethoxy]aniline |
|---|---|
| PubChem CID | 39399797 |
| Molecular Formula | C16H18ClNO2 |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 2-chloro-5-[2-(2,6-dimethylphenoxy)ethoxy]aniline |
| SMILES | Cc1cccc(C)c1OCCOc1ccc(Cl)c(N)c1 |
| InChI | InChI=1S/C16H18ClNO2/c1-11-4-3-5-12(2)16(11)20-9-8-19-13-6-7-14(17)15(18)10-13/h3-7,10H,8-9,18H2,1-2H3 |
| InChIKey | UQCGNGYMAQFFSE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|