C19H25NO2 — CID 82097182
2-methyl-5-[3-(2,3,6-trimethylphenoxy)propoxy]aniline (PubChem CID 82097182) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is 2-methyl-5-[3-(2,3,6-trimethylphenoxy)propoxy]aniline.
| Compound Name | 2-methyl-5-[3-(2,3,6-trimethylphenoxy)propoxy]aniline |
|---|---|
| PubChem CID | 82097182 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 2-methyl-5-[3-(2,3,6-trimethylphenoxy)propoxy]aniline |
| SMILES | Cc1ccc(OCCCOc2c(C)ccc(C)c2C)cc1N |
| InChI | InChI=1S/C19H25NO2/c1-13-6-7-15(3)19(16(13)4)22-11-5-10-21-17-9-8-14(2)18(20)12-17/h6-9,12H,5,10-11,20H2,1-4H3 |
| InChIKey | PKZFSRQPZRGXDG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|