C13H22BrNO — CID 12633
2-(2,6-dimethylphenoxy)ethyl-trimethylazanium bromide (PubChem CID 12633) has the molecular formula C13H22BrNO and a molecular weight of 288.23 g/mol. Its IUPAC name is 2-(2,6-dimethylphenoxy)ethyl-trimethylazanium bromide.
| Compound Name | 2-(2,6-dimethylphenoxy)ethyl-trimethylazanium bromide |
|---|---|
| PubChem CID | 12633 |
| Molecular Formula | C13H22BrNO |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-(2,6-dimethylphenoxy)ethyl-trimethylazanium bromide |
| SMILES | Cc1cccc(C)c1OCC[N+](C)(C)C.[Br-] |
| InChI | InChI=1S/C13H22NO.BrH/c1-11-7-6-8-12(2)13(11)15-10-9-14(3,4)5;/h6-8H,9-10H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | ZFHWDLYDBITDJK-UHFFFAOYSA-M |
| XLogP | -0.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|