C14H22O2 — CID 106802636
6-(2,6-dimethylphenoxy)hexan-3-ol (PubChem CID 106802636) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 6-(2,6-dimethylphenoxy)hexan-3-ol.
| Compound Name | 6-(2,6-dimethylphenoxy)hexan-3-ol |
|---|---|
| PubChem CID | 106802636 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 6-(2,6-dimethylphenoxy)hexan-3-ol |
| SMILES | CCC(O)CCCOc1c(C)cccc1C |
| InChI | InChI=1S/C14H22O2/c1-4-13(15)9-6-10-16-14-11(2)7-5-8-12(14)3/h5,7-8,13,15H,4,6,9-10H2,1-3H3 |
| InChIKey | XOVXNURLVQSFPG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|