C27H42N2O4 — CID 90882834
4-amino-9-(2,6-dimethylphenoxy)-1-[2-(2,6-dimethylphenoxy)ethylamino]nonane-2,6-diol (PubChem CID 90882834) has the molecular formula C27H42N2O4 and a molecular weight of 458.64 g/mol. Its IUPAC name is 4-amino-9-(2,6-dimethylphenoxy)-1-[2-(2,6-dimethylphenoxy)ethylamino]nonane-2,6-diol.
| Compound Name | 4-amino-9-(2,6-dimethylphenoxy)-1-[2-(2,6-dimethylphenoxy)ethylamino]nonane-2,6-diol |
|---|---|
| PubChem CID | 90882834 |
| Molecular Formula | C27H42N2O4 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.31 |
| IUPAC Name | 4-amino-9-(2,6-dimethylphenoxy)-1-[2-(2,6-dimethylphenoxy)ethylamino]nonane-2,6-diol |
| SMILES | Cc1cccc(C)c1OCCCC(O)CC(N)CC(O)CNCCOc1c(C)cccc1C |
| InChI | InChI=1S/C27H42N2O4/c1-19-8-5-9-20(2)26(19)32-14-7-12-24(30)16-23(28)17-25(31)18-29-13-15-33-27-21(3)10-6-11-22(27)4/h5-6,8-11,23-25,29-31H,7,12-18,28H2,1-4H3 |
| InChIKey | BQSBJZKFKPRHPI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|