C14H23NOS — CID 87875989
(2S)-2-amino-6-(2,6-dimethylphenoxy)hexane-1-thiol (PubChem CID 87875989) has the molecular formula C14H23NOS and a molecular weight of 253.41 g/mol. Its IUPAC name is (2S)-2-amino-6-(2,6-dimethylphenoxy)hexane-1-thiol.
| Compound Name | (2S)-2-amino-6-(2,6-dimethylphenoxy)hexane-1-thiol |
|---|---|
| PubChem CID | 87875989 |
| Molecular Formula | C14H23NOS |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (2S)-2-amino-6-(2,6-dimethylphenoxy)hexane-1-thiol |
| SMILES | Cc1cccc(C)c1OCCCC[C@H](N)CS |
| InChI | InChI=1S/C14H23NOS/c1-11-6-5-7-12(2)14(11)16-9-4-3-8-13(15)10-17/h5-7,13,17H,3-4,8-10,15H2,1-2H3/t13-/m0/s1 |
| InChIKey | TWPSTRYQOIZOGB-ZDUSSCGKSA-N |
| XLogP | 3.11 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|