C12H19Cl2NOS — CID 18435831
2-amino-6-(3-chlorophenoxy)hexane-1-thiol;hydrochloride (PubChem CID 18435831) has the molecular formula C12H19Cl2NOS and a molecular weight of 296.26 g/mol. Its IUPAC name is 2-amino-6-(3-chlorophenoxy)hexane-1-thiol;hydrochloride.
| Compound Name | 2-amino-6-(3-chlorophenoxy)hexane-1-thiol;hydrochloride |
|---|---|
| PubChem CID | 18435831 |
| Molecular Formula | C12H19Cl2NOS |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 2-amino-6-(3-chlorophenoxy)hexane-1-thiol;hydrochloride |
| SMILES | Cl.NC(CS)CCCCOc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H18ClNOS.ClH/c13-10-4-3-6-12(8-10)15-7-2-1-5-11(14)9-16;/h3-4,6,8,11,16H,1-2,5,7,9,14H2;1H |
| InChIKey | DGSFNQWWDZWMHE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|