C14H24ClNOS — CID 18435861
2-amino-6-(3-ethylphenoxy)hexane-1-thiol;hydrochloride (PubChem CID 18435861) has the molecular formula C14H24ClNOS and a molecular weight of 289.87 g/mol. Its IUPAC name is 2-amino-6-(3-ethylphenoxy)hexane-1-thiol;hydrochloride.
| Compound Name | 2-amino-6-(3-ethylphenoxy)hexane-1-thiol;hydrochloride |
|---|---|
| PubChem CID | 18435861 |
| Molecular Formula | C14H24ClNOS |
| Molecular Weight | 289.87 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-amino-6-(3-ethylphenoxy)hexane-1-thiol;hydrochloride |
| SMILES | CCc1cccc(OCCCCC(N)CS)c1.Cl |
| InChI | InChI=1S/C14H23NOS.ClH/c1-2-12-6-5-8-14(10-12)16-9-4-3-7-13(15)11-17;/h5-6,8,10,13,17H,2-4,7,9,11,15H2,1H3;1H |
| InChIKey | NSIQDNMKLNNRBT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.87 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|