C14H23NO2S — CID 63967301
1-(2,6-dimethylphenoxy)-3-(2-methylsulfanylethylamino)propan-2-ol (PubChem CID 63967301) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is 1-(2,6-dimethylphenoxy)-3-(2-methylsulfanylethylamino)propan-2-ol.
| Compound Name | 1-(2,6-dimethylphenoxy)-3-(2-methylsulfanylethylamino)propan-2-ol |
|---|---|
| PubChem CID | 63967301 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 1-(2,6-dimethylphenoxy)-3-(2-methylsulfanylethylamino)propan-2-ol |
| SMILES | CSCCNCC(O)COc1c(C)cccc1C |
| InChI | InChI=1S/C14H23NO2S/c1-11-5-4-6-12(2)14(11)17-10-13(16)9-15-7-8-18-3/h4-6,13,15-16H,7-10H2,1-3H3 |
| InChIKey | IYKOGLGMTGEMDZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|