About 6-anilinooxyhexan-3-ol
6-anilinooxyhexan-3-ol (PubChem CID 21497197) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is 6-anilinooxyhexan-3-ol.
Molecular Properties
| Compound Name | 6-anilinooxyhexan-3-ol |
| PubChem CID | 21497197 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 6-anilinooxyhexan-3-ol |
| SMILES | CCC(O)CCCONc1ccccc1 |
| InChI | InChI=1S/C12H19NO2/c1-2-12(14)9-6-10-15-13-11-7-4-3-5-8-11/h3-5,7-8,12-14H,2,6,9-10H2,1H3 |
| InChIKey | QGRXXGMBFCRILN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-anilinooxyhexan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-anilinooxyhexan-3-ol?
The IUPAC name of 6-anilinooxyhexan-3-ol (CID 21497197) is 6-anilinooxyhexan-3-ol.
What is the SMILES notation for 6-anilinooxyhexan-3-ol?
The canonical SMILES for 6-anilinooxyhexan-3-ol is CCC(O)CCCONc1ccccc1.
What is the InChIKey of 6-anilinooxyhexan-3-ol?
The InChIKey is QGRXXGMBFCRILN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2/c1-2-12(14)9-6-10-15-13-11-7-4-3-5-8-11/h3-5,7-8,12-14H,2,6,9-10H2,1H3.
What are the key properties of 6-anilinooxyhexan-3-ol?
6-anilinooxyhexan-3-ol has a molecular weight of 209.29 g/mol, XLogP of 2.58, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-anilinooxyhexan-3-ol is sourced from PubChem (CID 21497197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).