About 2-ethylhexoxy(oxo)phosphanium;iron(3+)
2-ethylhexoxy(oxo)phosphanium;iron(3+) (PubChem CID 158223582) has the molecular formula C8H18FeO2P+4
and a molecular weight of 233.05 g/mol. Its IUPAC name is 2-ethylhexoxy(oxo)phosphanium;iron(3+).
Molecular Properties
| Compound Name | 2-ethylhexoxy(oxo)phosphanium;iron(3+) |
| PubChem CID | 158223582 |
| Molecular Formula | C8H18FeO2P+4 |
| Molecular Weight | 233.05 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 2-ethylhexoxy(oxo)phosphanium;iron(3+) |
| SMILES | CCCCC(CC)CO[PH+]=O.[Fe+3] |
| InChI | InChI=1S/C8H18O2P.Fe/c1-3-5-6-8(4-2)7-10-11-9;/h8,11H,3-7H2,1-2H3;/q+1;+3 |
| InChIKey | AXQXOBVHVDIYIZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.05 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexoxy(oxo)phosphanium;iron(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexoxy(oxo)phosphanium;iron(3+)?
The IUPAC name of 2-ethylhexoxy(oxo)phosphanium;iron(3+) (CID 158223582) is 2-ethylhexoxy(oxo)phosphanium;iron(3+).
What is the SMILES notation for 2-ethylhexoxy(oxo)phosphanium;iron(3+)?
The canonical SMILES for 2-ethylhexoxy(oxo)phosphanium;iron(3+) is CCCCC(CC)CO[PH+]=O.[Fe+3].
What is the InChIKey of 2-ethylhexoxy(oxo)phosphanium;iron(3+)?
The InChIKey is AXQXOBVHVDIYIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O2P.Fe/c1-3-5-6-8(4-2)7-10-11-9;/h8,11H,3-7H2,1-2H3;/q+1;+3.
What are the key properties of 2-ethylhexoxy(oxo)phosphanium;iron(3+)?
2-ethylhexoxy(oxo)phosphanium;iron(3+) has a molecular weight of 233.05 g/mol, XLogP of 3.16, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexoxy(oxo)phosphanium;iron(3+) is sourced from PubChem (CID 158223582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).