C11H23O3P — CID 130318479
cyclopentylmethyl-[(2-methylpropan-2-yl)oxymethyl]phosphinic acid (PubChem CID 130318479) has the molecular formula C11H23O3P and a molecular weight of 234.28 g/mol. Its IUPAC name is cyclopentylmethyl-[(2-methylpropan-2-yl)oxymethyl]phosphinic acid.
| Compound Name | cyclopentylmethyl-[(2-methylpropan-2-yl)oxymethyl]phosphinic acid |
|---|---|
| PubChem CID | 130318479 |
| Molecular Formula | C11H23O3P |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | cyclopentylmethyl-[(2-methylpropan-2-yl)oxymethyl]phosphinic acid |
| SMILES | CC(C)(C)OCP(=O)(O)CC1CCCC1 |
| InChI | InChI=1S/C11H23O3P/c1-11(2,3)14-9-15(12,13)8-10-6-4-5-7-10/h10H,4-9H2,1-3H3,(H,12,13) |
| InChIKey | NLEVLWLJUFOKOJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|