C12H27O4P — CID 10468119
1-[1,1-diethoxyethyl(ethoxy)phosphoryl]-2-methylpropane (PubChem CID 10468119) has the molecular formula C12H27O4P and a molecular weight of 266.32 g/mol. Its IUPAC name is 1-[1,1-diethoxyethyl(ethoxy)phosphoryl]-2-methylpropane.
| Compound Name | 1-[1,1-diethoxyethyl(ethoxy)phosphoryl]-2-methylpropane |
|---|---|
| PubChem CID | 10468119 |
| Molecular Formula | C12H27O4P |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 1-[1,1-diethoxyethyl(ethoxy)phosphoryl]-2-methylpropane |
| SMILES | CCOC(C)(OCC)P(=O)(CC(C)C)OCC |
| InChI | InChI=1S/C12H27O4P/c1-7-14-12(6,15-8-2)17(13,16-9-3)10-11(4)5/h11H,7-10H2,1-6H3 |
| InChIKey | YJEISNAOYSTXAR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|