C20H36NO5PS — CID 102507556
N-[(1R)-2-[1,1-diethoxyethyl(ethoxy)phosphoryl]-1-phenylethyl]-2-methylpropane-2-sulfinamide (PubChem CID 102507556) has the molecular formula C20H36NO5PS and a molecular weight of 433.55 g/mol. Its IUPAC name is N-[(1R)-2-[1,1-diethoxyethyl(ethoxy)phosphoryl]-1-phenylethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(1R)-2-[1,1-diethoxyethyl(ethoxy)phosphoryl]-1-phenylethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 102507556 |
| Molecular Formula | C20H36NO5PS |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | N-[(1R)-2-[1,1-diethoxyethyl(ethoxy)phosphoryl]-1-phenylethyl]-2-methylpropane-2-sulfinamide |
| SMILES | CCOC(C)(OCC)P(=O)(C[C@H](NS(=O)C(C)(C)C)c1ccccc1)OCC |
| InChI | InChI=1S/C20H36NO5PS/c1-8-24-20(7,25-9-2)27(22,26-10-3)16-18(17-14-12-11-13-15-17)21-28(23)19(4,5)6/h11-15,18,21H,8-10,16H2,1-7H3/t18-,27?,28?/m0/s1 |
| InChIKey | BOKVJZFHWOXMTG-WBZDIBOQSA-N |
| XLogP | 4.84 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|