C15H24NO3P — CID 12765070
1-benzyl-2-diethoxyphosphorylpyrrolidine (PubChem CID 12765070) has the molecular formula C15H24NO3P and a molecular weight of 297.33 g/mol. Its IUPAC name is 1-benzyl-2-diethoxyphosphorylpyrrolidine.
| Compound Name | 1-benzyl-2-diethoxyphosphorylpyrrolidine |
|---|---|
| PubChem CID | 12765070 |
| Molecular Formula | C15H24NO3P |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 1-benzyl-2-diethoxyphosphorylpyrrolidine |
| SMILES | CCOP(=O)(OCC)C1CCCN1Cc1ccccc1 |
| InChI | InChI=1S/C15H24NO3P/c1-3-18-20(17,19-4-2)15-11-8-12-16(15)13-14-9-6-5-7-10-14/h5-7,9-10,15H,3-4,8,11-13H2,1-2H3 |
| InChIKey | QLXLMJAWDZUWSX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|