C16H26N2 — CID 123575402
1-benzyl-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrimidine;ethane (PubChem CID 123575402) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 1-benzyl-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrimidine;ethane.
| Compound Name | 1-benzyl-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrimidine;ethane |
|---|---|
| PubChem CID | 123575402 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 1-benzyl-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrimidine;ethane |
| SMILES | CC.c1ccc(CN2CCCN3CCCC32)cc1 |
| InChI | InChI=1S/C14H20N2.C2H6/c1-2-6-13(7-3-1)12-16-11-5-10-15-9-4-8-14(15)16;1-2/h1-3,6-7,14H,4-5,8-12H2;1-2H3 |
| InChIKey | VQPRWAYXLBAUIT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |