C14H18N2 — CID 163828667
1-benzyl-3,4,8,8a-tetrahydro-2H-pyrrolo[1,2-a]pyrimidine (PubChem CID 163828667) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 1-benzyl-3,4,8,8a-tetrahydro-2H-pyrrolo[1,2-a]pyrimidine.
| Compound Name | 1-benzyl-3,4,8,8a-tetrahydro-2H-pyrrolo[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 163828667 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 1-benzyl-3,4,8,8a-tetrahydro-2H-pyrrolo[1,2-a]pyrimidine |
| SMILES | C1=CN2CCCN(Cc3ccccc3)C2C1 |
| InChI | InChI=1S/C14H18N2/c1-2-6-13(7-3-1)12-16-11-5-10-15-9-4-8-14(15)16/h1-4,6-7,9,14H,5,8,10-12H2 |
| InChIKey | OBTSOMGSQIOUTG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |