C19H21N — CID 11196325
1,6-dibenzyl-3,6-dihydro-2H-pyridine (PubChem CID 11196325) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is 1,6-dibenzyl-3,6-dihydro-2H-pyridine.
| Compound Name | 1,6-dibenzyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 11196325 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 1,6-dibenzyl-3,6-dihydro-2H-pyridine |
| SMILES | C1=CC(Cc2ccccc2)N(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H21N/c1-3-9-17(10-4-1)15-19-13-7-8-14-20(19)16-18-11-5-2-6-12-18/h1-7,9-13,19H,8,14-16H2 |
| InChIKey | FUHWHUVMOXKZPA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|