C15H21NO — CID 22393845
4-[(6-propyl-3,6-dihydro-2H-pyridin-1-yl)methyl]phenol (PubChem CID 22393845) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 4-[(6-propyl-3,6-dihydro-2H-pyridin-1-yl)methyl]phenol.
| Compound Name | 4-[(6-propyl-3,6-dihydro-2H-pyridin-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 22393845 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 4-[(6-propyl-3,6-dihydro-2H-pyridin-1-yl)methyl]phenol |
| SMILES | CCCC1C=CCCN1Cc1ccc(O)cc1 |
| InChI | InChI=1S/C15H21NO/c1-2-5-14-6-3-4-11-16(14)12-13-7-9-15(17)10-8-13/h3,6-10,14,17H,2,4-5,11-12H2,1H3 |
| InChIKey | XEVAQMULULIICH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|