C20H24N4O — CID 50960208
N-(6-methylpyridazin-3-yl)-4-[(2-propyl-2,5-dihydropyrrol-1-yl)methyl]benzamide (PubChem CID 50960208) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is N-(6-methylpyridazin-3-yl)-4-[(2-propyl-2,5-dihydropyrrol-1-yl)methyl]benzamide.
| Compound Name | N-(6-methylpyridazin-3-yl)-4-[(2-propyl-2,5-dihydropyrrol-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 50960208 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-(6-methylpyridazin-3-yl)-4-[(2-propyl-2,5-dihydropyrrol-1-yl)methyl]benzamide |
| SMILES | CCCC1C=CCN1Cc1ccc(C(=O)Nc2ccc(C)nn2)cc1 |
| InChI | InChI=1S/C20H24N4O/c1-3-5-18-6-4-13-24(18)14-16-8-10-17(11-9-16)20(25)21-19-12-7-15(2)22-23-19/h4,6-12,18H,3,5,13-14H2,1-2H3,(H,21,23,25) |
| InChIKey | WQYLGMUUUYYYKS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|