C15H18ClN5O — CID 113039930
4-chloro-N-[6-[2-(dimethylamino)ethylamino]pyridazin-3-yl]benzamide (PubChem CID 113039930) has the molecular formula C15H18ClN5O and a molecular weight of 319.80 g/mol. Its IUPAC name is 4-chloro-N-[6-[2-(dimethylamino)ethylamino]pyridazin-3-yl]benzamide.
| Compound Name | 4-chloro-N-[6-[2-(dimethylamino)ethylamino]pyridazin-3-yl]benzamide |
|---|---|
| PubChem CID | 113039930 |
| Molecular Formula | C15H18ClN5O |
| Molecular Weight | 319.80 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 4-chloro-N-[6-[2-(dimethylamino)ethylamino]pyridazin-3-yl]benzamide |
| SMILES | CN(C)CCNc1ccc(NC(=O)c2ccc(Cl)cc2)nn1 |
| InChI | InChI=1S/C15H18ClN5O/c1-21(2)10-9-17-13-7-8-14(20-19-13)18-15(22)11-3-5-12(16)6-4-11/h3-8H,9-10H2,1-2H3,(H,17,19)(H,18,20,22) |
| InChIKey | VHFUVRUKKSIYNH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.80 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |