C16H19Cl2N5O — CID 113040114
3,4-dichloro-N-[6-[3-(dimethylamino)propylamino]pyridazin-3-yl]benzamide (PubChem CID 113040114) has the molecular formula C16H19Cl2N5O and a molecular weight of 368.27 g/mol. Its IUPAC name is 3,4-dichloro-N-[6-[3-(dimethylamino)propylamino]pyridazin-3-yl]benzamide.
| Compound Name | 3,4-dichloro-N-[6-[3-(dimethylamino)propylamino]pyridazin-3-yl]benzamide |
|---|---|
| PubChem CID | 113040114 |
| Molecular Formula | C16H19Cl2N5O |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 3,4-dichloro-N-[6-[3-(dimethylamino)propylamino]pyridazin-3-yl]benzamide |
| SMILES | CN(C)CCCNc1ccc(NC(=O)c2ccc(Cl)c(Cl)c2)nn1 |
| InChI | InChI=1S/C16H19Cl2N5O/c1-23(2)9-3-8-19-14-6-7-15(22-21-14)20-16(24)11-4-5-12(17)13(18)10-11/h4-7,10H,3,8-9H2,1-2H3,(H,19,21)(H,20,22,24) |
| InChIKey | JYQHIPISJBVGOI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|