C20H23N — CID 10588595
(6S)-6-benzyl-1-[(1S)-1-phenylethyl]-3,6-dihydro-2H-pyridine (PubChem CID 10588595) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is (6S)-6-benzyl-1-[(1S)-1-phenylethyl]-3,6-dihydro-2H-pyridine.
| Compound Name | (6S)-6-benzyl-1-[(1S)-1-phenylethyl]-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 10588595 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | (6S)-6-benzyl-1-[(1S)-1-phenylethyl]-3,6-dihydro-2H-pyridine |
| SMILES | C[C@@H](c1ccccc1)N1CCC=C[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C20H23N/c1-17(19-12-6-3-7-13-19)21-15-9-8-14-20(21)16-18-10-4-2-5-11-18/h2-8,10-14,17,20H,9,15-16H2,1H3/t17-,20+/m0/s1 |
| InChIKey | IEOMTEXTYCQBED-FXAWDEMLSA-N |
| XLogP | 4.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|