C14H19NO — CID 10680302
(2R)-2-[(6R)-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-2-phenylethanol (PubChem CID 10680302) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is (2R)-2-[(6R)-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-2-phenylethanol.
| Compound Name | (2R)-2-[(6R)-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-2-phenylethanol |
|---|---|
| PubChem CID | 10680302 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (2R)-2-[(6R)-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-2-phenylethanol |
| SMILES | C[C@@H]1C=CCCN1[C@@H](CO)c1ccccc1 |
| InChI | InChI=1S/C14H19NO/c1-12-7-5-6-10-15(12)14(11-16)13-8-3-2-4-9-13/h2-5,7-9,12,14,16H,6,10-11H2,1H3/t12-,14+/m1/s1 |
| InChIKey | LDOHNMDPBCRIBJ-OCCSQVGLSA-N |
| XLogP | 2.37 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|