C19H27NO3 — CID 10734278
(2R)-2-[(2S,6S)-2-[2-(1,3-dioxolan-2-yl)ethyl]-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-2-phenylethanol (PubChem CID 10734278) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is (2R)-2-[(2S,6S)-2-[2-(1,3-dioxolan-2-yl)ethyl]-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-2-phenylethanol.
| Compound Name | (2R)-2-[(2S,6S)-2-[2-(1,3-dioxolan-2-yl)ethyl]-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-2-phenylethanol |
|---|---|
| PubChem CID | 10734278 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (2R)-2-[(2S,6S)-2-[2-(1,3-dioxolan-2-yl)ethyl]-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-2-phenylethanol |
| SMILES | C[C@H]1C=CC[C@H](CCC2OCCO2)N1[C@@H](CO)c1ccccc1 |
| InChI | InChI=1S/C19H27NO3/c1-15-6-5-9-17(10-11-19-22-12-13-23-19)20(15)18(14-21)16-7-3-2-4-8-16/h2-8,15,17-19,21H,9-14H2,1H3/t15-,17+,18-/m0/s1 |
| InChIKey | HCWFEQBSFZBOPC-JQHSSLGASA-N |
| XLogP | 2.89 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|