C24H25NO — CID 11089186
(2S)-2-[(2R,5S)-2,5-diphenylpyrrolidin-1-yl]-2-phenylethanol (PubChem CID 11089186) has the molecular formula C24H25NO and a molecular weight of 343.47 g/mol. Its IUPAC name is (2S)-2-[(2R,5S)-2,5-diphenylpyrrolidin-1-yl]-2-phenylethanol.
| Compound Name | (2S)-2-[(2R,5S)-2,5-diphenylpyrrolidin-1-yl]-2-phenylethanol |
|---|---|
| PubChem CID | 11089186 |
| Molecular Formula | C24H25NO |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (2S)-2-[(2R,5S)-2,5-diphenylpyrrolidin-1-yl]-2-phenylethanol |
| SMILES | OC[C@H](c1ccccc1)N1[C@@H](c2ccccc2)CC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H25NO/c26-18-24(21-14-8-3-9-15-21)25-22(19-10-4-1-5-11-19)16-17-23(25)20-12-6-2-7-13-20/h1-15,22-24,26H,16-18H2/t22-,23+,24-/m1/s1 |
| InChIKey | UOMPNMLRYVWCNL-TZRRMPRUSA-N |
| XLogP | 5.30 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |