C18H18BrNO2 — CID 174483543
(5R)-5-(4-bromophenyl)-1-(2-hydroxy-1-phenylethyl)pyrrolidin-2-one (PubChem CID 174483543) has the molecular formula C18H18BrNO2 and a molecular weight of 360.25 g/mol. Its IUPAC name is (5R)-5-(4-bromophenyl)-1-(2-hydroxy-1-phenylethyl)pyrrolidin-2-one.
| Compound Name | (5R)-5-(4-bromophenyl)-1-(2-hydroxy-1-phenylethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 174483543 |
| Molecular Formula | C18H18BrNO2 |
| Molecular Weight | 360.25 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | (5R)-5-(4-bromophenyl)-1-(2-hydroxy-1-phenylethyl)pyrrolidin-2-one |
| SMILES | O=C1CC[C@H](c2ccc(Br)cc2)N1C(CO)c1ccccc1 |
| InChI | InChI=1S/C18H18BrNO2/c19-15-8-6-14(7-9-15)16-10-11-18(22)20(16)17(12-21)13-4-2-1-3-5-13/h1-9,16-17,21H,10-12H2/t16-,17?/m1/s1 |
| InChIKey | PEDVSTDPGXZEQO-TZHYSIJRSA-N |
| XLogP | 3.85 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.25 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |