C20H22BrNO2 — CID 175388489
5-(4-bromophenyl)-1-[(1S)-2-hydroxy-1-phenylethyl]piperidine-2-carbaldehyde (PubChem CID 175388489) has the molecular formula C20H22BrNO2 and a molecular weight of 388.31 g/mol. Its IUPAC name is 5-(4-bromophenyl)-1-[(1S)-2-hydroxy-1-phenylethyl]piperidine-2-carbaldehyde.
| Compound Name | 5-(4-bromophenyl)-1-[(1S)-2-hydroxy-1-phenylethyl]piperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 175388489 |
| Molecular Formula | C20H22BrNO2 |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 5-(4-bromophenyl)-1-[(1S)-2-hydroxy-1-phenylethyl]piperidine-2-carbaldehyde |
| SMILES | O=CC1CCC(c2ccc(Br)cc2)CN1[C@H](CO)c1ccccc1 |
| InChI | InChI=1S/C20H22BrNO2/c21-18-9-6-15(7-10-18)17-8-11-19(13-23)22(12-17)20(14-24)16-4-2-1-3-5-16/h1-7,9-10,13,17,19-20,24H,8,11-12,14H2/t17?,19?,20-/m1/s1 |
| InChIKey | DEODLPWMQAIFIC-LYBXBRPPSA-N |
| XLogP | 3.93 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|