C15H23NO — CID 10609696
(2S)-2-[(2S)-2-ethylpiperidin-1-yl]-2-phenylethanol (PubChem CID 10609696) has the molecular formula C15H23NO and a molecular weight of 233.36 g/mol. Its IUPAC name is (2S)-2-[(2S)-2-ethylpiperidin-1-yl]-2-phenylethanol.
| Compound Name | (2S)-2-[(2S)-2-ethylpiperidin-1-yl]-2-phenylethanol |
|---|---|
| PubChem CID | 10609696 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | (2S)-2-[(2S)-2-ethylpiperidin-1-yl]-2-phenylethanol |
| SMILES | CC[C@H]1CCCCN1[C@H](CO)c1ccccc1 |
| InChI | InChI=1S/C15H23NO/c1-2-14-10-6-7-11-16(14)15(12-17)13-8-4-3-5-9-13/h3-5,8-9,14-15,17H,2,6-7,10-12H2,1H3/t14-,15+/m0/s1 |
| InChIKey | XKWMOLGHYQKNEH-LSDHHAIUSA-N |
| XLogP | 2.98 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |